Citric Acid
eMolecules 53381-05-8 | 2-ETHOXYCYCLOPROPANE-1-CARBOXYLIC ACID | AstaTech | MFCD11858184 | 130.143 | C6H10O3 | 95.000 | CCOC1CC1C(O)=O | 0.1g | 771348171
2-ETHOXYCYCLOPROPANE-1-CARBOXYLIC ACID | AstaTech | 53381-05-8 | MFCD11858184 | 130.143 | C6H10O3 | 95.000 | CCOC1CC1C(O)=O | 0.1g | 771348171
eMolecules 1628423-76-6 | Medchem Express | Pafolacianine | 1mg | 742367645 | HY-139579 | 1326.49 | C61H67N9O17S4
Medchem Express | Salazopyridazine | 25mg | 728132609 | HY-145455 | 22933-72-8 | MFCD00864769 | 429.410 | C18H15N5O6S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 204514-22-7 | Ambeed | 1-(((tert-Butoxycarbonyl)amino)methyl)cyclopentanecarboxylic acid | 100mg | 632809515 | A445615 | MFCD09264201 | 243.303 | C12H21NO4
Medchem Express | TCS-OX2-29 | 5mg | 446255494 | HY-100452 | 372523-75-6 | MFCD26142103 | 397.519 | C23H31N3O3
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 474923-47-2 | 18:1 Dodecanyl PE | Broadpharm978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473637.JPG-250.jpg)
eMolecules 474923-47-2 | 18:1 Dodecanyl PE | Broadpharm978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531
18:1 Dodecanyl PE | Broadpharm | 474923-47-2978.319 | C53H97NNaO11P | 0.000 | [Na+].CCCCCCCC\C=C/CCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCCNC(=O)CCCCCCCCCCC(O)=O)OC(=O)CCCCCCC\C=C/CCCCCCCC | 25mg | 771351531
eMolecules 1113-38-8 | Ambeed | Ammonium oxalate | 100g | 552536627 | A114144 | MFCD00013308 | 124.096 | C2H8N2O4
ChemScene | Oxazole-4-carbothioamide | 100mg | 569146536 | CS-0130151 | 118802-31-6 | MFCD06738920 | 128.150 | C4H4N2OS
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
![eMolecules 1175621-48-3 | 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-pentynoic acid | ChemScene213.233 | C10H15NO4 | 97.000 | CC(C)(C)OC(=O)NCCC#CC(O)=O | 100mg | 788449205](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502473074.JPG-250.jpg)
eMolecules 1175621-48-3 | 5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-pentynoic acid | ChemScene213.233 | C10H15NO4 | 97.000 | CC(C)(C)OC(=O)NCCC#CC(O)=O | 100mg | 788449205
5-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-pentynoic acid | ChemScene | 1175621-48-3213.233 | C10H15NO4 | 97.000 | CC(C)(C)OC(=O)NCCC#CC(O)=O | 100mg | 788449205
Chem-Impex International, Inc. Citric acid, anhydrous | 77-92-9 | MFCD00011669 | 10KG
Citric acid, anhydrous, 77-92-9, MFCD00011669, 10KG
Chem-Impex International, Inc. Citric acid monohydrate | 5949-29-1 | MFCD00149972 | 2.5KG
Citric acid monohydrate, 5949-29-1, MFCD00149972, 2.5KG
eMolecules 1070-83-3 | 3,3-Dimethylbutyric acid | Ambeed | MFCD00002715 | 116.160 | C6H12O2 | 98.000 | CC(C)(C)CC(O)=O | 10g | 552755356
3,3-Dimethylbutyric acid | Ambeed | 1070-83-3 | MFCD00002715 | 116.160 | C6H12O2 | 98.000 | CC(C)(C)CC(O)=O | 10g | 552755356
eMolecules 1730-91-2 | ChemScene | (S)-2-Methylbutanoic acid | 250mg | 572195006 | CS-0120626 | MFCD00063166 | 102.133 | C5H10O2
Ambeed | 2-(24-Dihydroxybenzoyl)benzoic acid | 100mg | 600831423 | A155090 | 2513-33-9 | MFCD00433869 | 258.229 | C14H10O5
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
![eMolecules 956965-37-0 | (R)-4-(3-(1H-Indol-3-yl)-2-(2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-2H-benzofuro[3,2-g]chromen-3-yl)acetamido)propanamido)butanoic acid | Synthonix583.641 | C33H33N3O7 | 95.000 | Cc1c(CC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCCC(O)=O)c(=O)oc2cc3oc4CCCCc4c3cc12 | 50mg | 78455...](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502478290.JPG-250.jpg)
eMolecules 956965-37-0 | (R)-4-(3-(1H-Indol-3-yl)-2-(2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-2H-benzofuro[3,2-g]chromen-3-yl)acetamido)propanamido)butanoic acid | Synthonix583.641 | C33H33N3O7 | 95.000 | Cc1c(CC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCCC(O)=O)c(=O)oc2cc3oc4CCCCc4c3cc12 | 50mg | 78455...
(R)-4-(3-(1H-Indol-3-yl)-2-(2-(4-methyl-2-oxo-6,7,8,9-tetrahydro-2H-benzofuro[3,2-g]chromen-3-yl)acetamido)propanamido)butanoic acid | Synthonix | 956965-37-0583.641 | C33H33N3O7 | 95.000 | Cc1c(CC(=O)N[C@H](Cc2c[nH]c3ccccc23)C(=O)NCCCC(O)=O)c(=O)oc2cc3oc4CCCCc4c3cc12 | 50mg | 784553701
eMolecules 2360221-58-3 | 4-Benzyloxycarbonylamino-4-pyridin-2-yl-butyric acid | J&W PharmLab LLC314.341 | C17H18N2O4 | 96.000 | OC(=O)CCC(NC(=O)OCc1ccccc1)c1ccccn1 | 1g | 761737023
4-Benzyloxycarbonylamino-4-pyridin-2-yl-butyric acid | J&W PharmLab LLC | 2360221-58-3314.341 | C17H18N2O4 | 96.000 | OC(=O)CCC(NC(=O)OCc1ccccc1)c1ccccn1 | 1g | 761737023
eMolecules 2763260-34-8 | Medchem Express | NRX-2663 | 5mg | 713706630 | HY-141448 | 418.328 | C20H13F3N2O5
Medchem Express | PR-104A | 5mg | 628192342 | HY-14572 | 680199-06-8 | MFCD19443670 | 499.290 | C14H19BrN4O9S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 57294-38-9 | Ambeed | Boc-GABA-OH | 10g | 552660753 | A226541 | MFCD00037313 | 203.238 | C9H17NO4
Ambeed | Boc-GABA-OH | 10g | 552660753 | A226541 | 57294-38-9 | MFCD00037313 | 203.238 | C9H17NO4